Product Search |
|
| Input Product Name Or Cas No. |
Category |
Products |
[4-(1,3-dioxaindan-5-yl)butan-2-yl]hydra |
1,1′-(Cyclohexylidenedi-4,1-phenylene) |
1,1′-(2,2′-Dimethyl[1,1′-biphenyl] |
1H-Pyrrole-2,5-dione, 1,1′,1′′-(ni |
4-(Phenoxymethyl)-1,1′-biphenyl |
2,3-Dihydro-3-(4-hydroxy-3,5-dimethylphe |
Sulfonium, triphenyl-, 1,2,2,2-tetrafluo |
1-[1-(Cyclohexylmethoxy)ethoxy]-4-etheny |
2’-oxospiro[bicyclo[2.2.1]heptane-2,5 |
2-methyl-2-(vinyloxy)adamantane |
6,6’-methylenebis(2-(2-hydroxy-5-methy |
2,4-Diethylphenol |
4,4′-Methylenebis[2-[(4-hydroxy-2-meth |
4,4′-Methylenebis[2-[(2-hydroxy-3,5-di |
6-vinylnaphthalen-2-yl trifluoromethanes |
3-(hydroxymethyl)-5-(2-hydroxypropan-2-y |
3,5-Bis(1-hydroxy-1-methylethyl)phenyl 2 |
1-phenyl-1-(4-(prop-1-en-2-yl)phenyl)eth |
3-(2-hydroxypropan-2-yl)adamantan-1-yl 2 |
3,5-bis(2-hydroxypropan-2-yl)adamantan-1 |
3,3,4-Trihydroxy-4-methylcyclopentyl 2-c |
Sulfonium, triphenyl-, salt with 2,4,6-t |
triphenylsulfonium 3,4,5-trihydroxybenzo |
Sulfonium, triphenyl-, salt with 2,6-dim |
Iodonium, bis[4-(1,1-dimethylethyl)pheny |
Sulfonium, (3,4-dihydroxyphenyl)diphenyl |
Sulfonium, (3,4-dihydroxyphenyl)diphenyl |
Sulfonium, triphenyl-, 3,4-dihydroxybenz |
Iodonium, bis[4-(1,1-dimethylethyl)pheny |
Iodonium, bis[4-(1,1-dimethylethyl)pheny |
Tetrahydro-4-methyl-2H-pyran-4-yl 4-ethe |
triphenylsulfonium 1-methyl-2,6-dioxocyc |
mono(triphenylsulfonium) mono(4-sulfonat |
adamantan-1-ylmethyl 2-chloroacrylate |
Triphenylsulfonium tetraphenylborate |
Naphthalene, 1-ethenyl-4-[[tris(1-methyl |
Ethyl α-[(phenylthioxomethyl)thio]benze |
N-(2-Methyl-1-oxopropyl)benzamide |
4-aminophenyl methacrylate |
2,2,2-Trifluoro-1-(trifluoromethyl)ethyl |
bis(4-(tert-butyl)phenyl)iodonium benzoa |
1-(1-Methylenepropyl)naphthalene |
2-Hydroxy-5-(1-methylethenyl)benzoic aci |
dimethyl 2-(3-chloro-5-fluoropyridin-2-y |
2-(3-chloro-5-fluoropyridin-2-yl)propano |
methyl 2-(3-chloro-5-fluoropyridin-2-yl) |
Pyrimidine, 5-bromo-2-[1-[[(1,1-dimethyl |
(2-(1-((tert-butyldimethylsilyl)oxy)buty |
Benzonitrile, 4-amino-2-methyl-5-(4,4,5, |
tert-butyl (2-(1-fluorocyclopropyl)pyrid |
|
Products |
| Catalogue Number |
Products |
CAS No. |
Assay |
| W730010 | tert-butyl 3-chloro-4-(isoxazol-5-yl)phenylcarbamate | 1098070-79-1 | 95% |
| W730011 | 2-(trimethylsilyl)ethyl 3-chloro-4-(1-hydroxyethyl)phenylcarbamate | 1098070-78-0 | 95% |
| W730012 | 3-chloro-4-ethenylBenzenamine | 1098070-77-9 | 95% |
| W730013 | 2-chloro-3-methoxy-6-nitroPhenol | 1098070-76-8 | 95% |
| W730014 | 1,3-diiodo-2,4-dimethoxy-5-nitroBenzene | 1098070-75-7 | 95% |
| W730015 | N-(2-chloro-4-nitrophenyl)-N,1-dimethyl-3-Pyrrolidinamine | 1098070-74-6 | 95% |
| W730016 | N-(4-amino-3-methoxyphenyl)-2-Furancarboxamide | 1098070-73-5 | 95% |
| W730017 | N-(4-aminophenyl)-4-(3-furanyl)-1,2,3-Thiadiazole-5-carboxamide | 1098070-70-2 | 95% |
| W730018 | 5-chloro-N1,N1-dimethyl-1,3-Benzenediamine | 1098070-69-9 | 95% |
| W730019 | 5-tert-butyl-N-(4-aminophenyl)furan-2-carboxamide | 1098070-66-6 | 95% |
| W730020 | 3-(2-morpholinoethoxy)-N-(4-aminophenyl)benzamide | 1098070-65-5 | 95% |
| W730021 | N-(4-aminophenyl)-3-[2-(dimethylamino)ethoxy]Benzamide | 1098070-64-4 | 95% |
| W730022 | N-(4-aminophenyl)-4-Isoquinolinecarboxamide | 1098070-61-1 | 95% |
| W730023 | N-(4-aminophenyl)-1-Isoquinolinecarboxamide | 1098070-60-0 | 95% |
| W730024 | N-(4-aminophenyl)-8-Quinolinecarboxamide | 1098070-59-7 | 95% |
| W730025 | N-(4-aminophenyl)-1H-Pyrrole-2-carboxamide | 1098070-58-6 | 95% |
| W730026 | tert-butyl 4-(1,2,3-thiadiazole-4-carboxamido)benzylcarbamate | 1098070-57-5 | 95% |
| W730027 | tert-butyl 4-(4-phenyl-1,2,3-thiadiazole-5-carboxamido)phenylcarbamate | 1098070-56-4 | 95% |
| W730028 | tert-butyl 4-(4-methyl-1,2,3-thiadiazole-5-carboxamido)phenylcarbamate | 1098070-55-3 | 95% |
| W730029 | tert-butyl 4-(isoquinoline-4-carboxamido)phenylcarbamate | 1098070-53-1 | 95% |
| W730030 | tert-butyl 4-(1,2,3-thiadiazole-4-carboxamido)phenylcarbamate | 1098070-52-0 | 95% |
| W730031 | tert-butyl 3-chloro-5-(dimethylamino)phenylcarbamate | 1098070-43-9 | 95% |
| W730032 | N-[3-chloro-5-(dimethylamino)phenyl]Acetamide | 1098070-42-8 | 95% |
| W730033 | ethyl 4-(furan-3-yl)-1,2,3-thiadiazole-5-carboxylate | 1098070-40-6 | 95% |
| W730034 | N-(4-aminophenyl)-4-bromo-2-Furancarboxamide | 1098070-38-2 | 95% |
| W730035 | N-(4-aminophenyl)-5-nitro-2-Furancarboxamide | 1098070-37-1 | 95% |
| W730036 | methyl 3-(4-aminophenylcarbamoyl)benzoate | 1098070-36-0 | 95% |
| W730037 | 2-(4-amino-2,6-dichlorophenoxy)Acetamide | 1098070-34-8 | 95% |
| W730038 | 5-chloro-4-methoxy-2-(1-piperidinyl)Benzenamine | 1098070-33-7 | 95% |
| W730039 | 2-(4-amino-2-chloro-5-methoxyphenoxy)Acetamide | 1098070-32-6 | 95% |
|
|
|
|